C10H17F2NaO6S — CID 58870513
sodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate (PubChem CID 58870513) has the molecular formula C10H17F2NaO6S and a molecular weight of 326.29 g/mol. Its IUPAC name is sodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate.
| Compound Name | sodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate |
|---|---|
| PubChem CID | 58870513 |
| Molecular Formula | C10H17F2NaO6S |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | sodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate |
| SMILES | O=C(OCCCCCCCCO)C(F)(F)SOO[O-].[Na+] |
| InChI | InChI=1S/C10H18F2O6S.Na/c11-10(12,19-18-17-15)9(14)16-8-6-4-2-1-3-5-7-13;/h13,15H,1-8H2;/q;+1/p-1 |
| InChIKey | CLFPMJKPPFXKOQ-UHFFFAOYSA-M |
| XLogP | -1.67 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|