sodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate

C10H17F2NaO6S — CID 58870513

IUPACsodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate
SMILESO=C(OCCCCCCCCO)C(F)(F)SOO[O-].[Na+]
InChIInChI=1S/C10H18F2O6S.Na/c11-10(12,19-18-17-15)9(14)16-8-6-4-2-1-3-5-7-13;/h13,15H,1-8H2;/q;+1/p-1
InChIKeyCLFPMJKPPFXKOQ-UHFFFAOYSA-M
MW326.29 g/mol
LogP-1.67
Rot. Bonds12

About sodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate

sodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate (PubChem CID 58870513) has the molecular formula C10H17F2NaO6S and a molecular weight of 326.29 g/mol. Its IUPAC name is sodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate.

Molecular Properties

Compound Namesodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate
PubChem CID58870513
Molecular FormulaC10H17F2NaO6S
Molecular Weight326.29 g/mol
Exact Mass326.06
IUPAC Namesodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate
SMILESO=C(OCCCCCCCCO)C(F)(F)SOO[O-].[Na+]
InChIInChI=1S/C10H18F2O6S.Na/c11-10(12,19-18-17-15)9(14)16-8-6-4-2-1-3-5-7-13;/h13,15H,1-8H2;/q;+1/p-1
InChIKeyCLFPMJKPPFXKOQ-UHFFFAOYSA-M
XLogP-1.67
TPSA88.05 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds12
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.29
LogP ≤ 5-1.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}

Analyze sodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Frequently Asked Questions

What is the IUPAC name of sodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate?
The IUPAC name of sodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate (CID 58870513) is sodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate.
What is the SMILES notation for sodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate?
The canonical SMILES for sodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate is O=C(OCCCCCCCCO)C(F)(F)SOO[O-].[Na+].
What is the InChIKey of sodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate?
The InChIKey is CLFPMJKPPFXKOQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H18F2O6S.Na/c11-10(12,19-18-17-15)9(14)16-8-6-4-2-1-3-5-7-13;/h13,15H,1-8H2;/q;+1/p-1.
What are the key properties of sodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate?
sodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate has a molecular weight of 326.29 g/mol, XLogP of -1.67, 12 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 8-hydroxyoctyl 2,2-difluoro-2-oxidoperoxysulfanylacetate is sourced from PubChem (CID 58870513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).