C10H15F2NaO6S — CID 58870543
sodium [4-(hydroxymethyl)cyclohexyl]methyl 2,2-difluoro-2-oxidoperoxysulfanylacetate (PubChem CID 58870543) has the molecular formula C10H15F2NaO6S and a molecular weight of 324.28 g/mol. Its IUPAC name is sodium [4-(hydroxymethyl)cyclohexyl]methyl 2,2-difluoro-2-oxidoperoxysulfanylacetate.
| Compound Name | sodium [4-(hydroxymethyl)cyclohexyl]methyl 2,2-difluoro-2-oxidoperoxysulfanylacetate |
|---|---|
| PubChem CID | 58870543 |
| Molecular Formula | C10H15F2NaO6S |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | sodium [4-(hydroxymethyl)cyclohexyl]methyl 2,2-difluoro-2-oxidoperoxysulfanylacetate |
| SMILES | O=C(OCC1CCC(CO)CC1)C(F)(F)SOO[O-].[Na+] |
| InChI | InChI=1S/C10H16F2O6S.Na/c11-10(12,19-18-17-15)9(14)16-6-8-3-1-7(5-13)2-4-8;/h7-8,13,15H,1-6H2;/q;+1/p-1 |
| InChIKey | XIYZQAPITQJDOR-UHFFFAOYSA-M |
| XLogP | -2.20 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|