C11H18FO6S- — CID 58870541
[4-(hydroxymethyl)cyclohexyl]methyl 2-fluoro-2-oxidoperoxysulfanylpropanoate (PubChem CID 58870541) has the molecular formula C11H18FO6S- and a molecular weight of 297.32 g/mol. Its IUPAC name is [4-(hydroxymethyl)cyclohexyl]methyl 2-fluoro-2-oxidoperoxysulfanylpropanoate.
| Compound Name | [4-(hydroxymethyl)cyclohexyl]methyl 2-fluoro-2-oxidoperoxysulfanylpropanoate |
|---|---|
| PubChem CID | 58870541 |
| Molecular Formula | C11H18FO6S- |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | [4-(hydroxymethyl)cyclohexyl]methyl 2-fluoro-2-oxidoperoxysulfanylpropanoate |
| SMILES | CC(F)(SOO[O-])C(=O)OCC1CCC(CO)CC1 |
| InChI | InChI=1S/C11H19FO6S/c1-11(12,19-18-17-15)10(14)16-7-9-4-2-8(6-13)3-5-9/h8-9,13,15H,2-7H2,1H3/p-1 |
| InChIKey | XXLJXYSVIIQRFG-UHFFFAOYSA-M |
| XLogP | 0.89 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|