C7H9F2O6S- — CID 59349960
(4-methyloxolan-3-yl) 2,2-difluoro-2-oxidoperoxysulfanylacetate (PubChem CID 59349960) has the molecular formula C7H9F2O6S- and a molecular weight of 259.21 g/mol. Its IUPAC name is (4-methyloxolan-3-yl) 2,2-difluoro-2-oxidoperoxysulfanylacetate.
| Compound Name | (4-methyloxolan-3-yl) 2,2-difluoro-2-oxidoperoxysulfanylacetate |
|---|---|
| PubChem CID | 59349960 |
| Molecular Formula | C7H9F2O6S- |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | (4-methyloxolan-3-yl) 2,2-difluoro-2-oxidoperoxysulfanylacetate |
| SMILES | CC1COCC1OC(=O)C(F)(F)SOO[O-] |
| InChI | InChI=1S/C7H10F2O6S/c1-4-2-12-3-5(4)13-6(10)7(8,9)16-15-14-11/h4-5,11H,2-3H2,1H3/p-1 |
| InChIKey | IFXJXCDGZOJDCR-UHFFFAOYSA-M |
| XLogP | 0.03 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|