C10H6F2NO8S- — CID 59602123
(6-cyano-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-difluoro-2-oxidoperoxysulfanylacetate (PubChem CID 59602123) has the molecular formula C10H6F2NO8S- and a molecular weight of 338.22 g/mol. Its IUPAC name is (6-cyano-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-difluoro-2-oxidoperoxysulfanylacetate.
| Compound Name | (6-cyano-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-difluoro-2-oxidoperoxysulfanylacetate |
|---|---|
| PubChem CID | 59602123 |
| Molecular Formula | C10H6F2NO8S- |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | (6-cyano-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl) 2,2-difluoro-2-oxidoperoxysulfanylacetate |
| SMILES | N#CC12CC3OC1C(OC2=O)C3OC(=O)C(F)(F)SOO[O-] |
| InChI | InChI=1S/C10H7F2NO8S/c11-10(12,22-21-20-16)8(15)18-4-3-1-9(2-13)6(17-3)5(4)19-7(9)14/h3-6,16H,1H2/p-1 |
| InChIKey | CWFVWODPKIHGJY-UHFFFAOYSA-M |
| XLogP | -1.03 |
| TPSA | 127.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|