C22H25F2O10S- — CID 58264691
(3-hydroxy-1-adamantyl)methyl 2-(2,2-difluoro-2-oxidoperoxysulfanylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 58264691) has the molecular formula C22H25F2O10S- and a molecular weight of 519.50 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl)methyl 2-(2,2-difluoro-2-oxidoperoxysulfanylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | (3-hydroxy-1-adamantyl)methyl 2-(2,2-difluoro-2-oxidoperoxysulfanylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 58264691 |
| Molecular Formula | C22H25F2O10S- |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | (3-hydroxy-1-adamantyl)methyl 2-(2,2-difluoro-2-oxidoperoxysulfanylacetyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | O=C1OC2C3CC(C2OC(=O)C(F)(F)SOO[O-])C(C(=O)OCC24CC5CC(CC(O)(C5)C2)C4)C13 |
| InChI | InChI=1S/C22H26F2O10S/c23-22(24,35-34-33-29)19(27)32-16-11-2-12-14(18(26)31-15(12)16)13(11)17(25)30-8-20-3-9-1-10(4-20)6-21(28,5-9)7-20/h9-16,28-29H,1-8H2/p-1 |
| InChIKey | MDYVMCRBJHZHBN-UHFFFAOYSA-M |
| XLogP | 1.04 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|