C14H19F2O7S- — CID 59547558
[3-hydroxy-5-(hydroxymethyl)-1-adamantyl]methyl 2,2-difluoro-2-oxidoperoxysulfanylacetate (PubChem CID 59547558) has the molecular formula C14H19F2O7S- and a molecular weight of 369.36 g/mol. Its IUPAC name is [3-hydroxy-5-(hydroxymethyl)-1-adamantyl]methyl 2,2-difluoro-2-oxidoperoxysulfanylacetate.
| Compound Name | [3-hydroxy-5-(hydroxymethyl)-1-adamantyl]methyl 2,2-difluoro-2-oxidoperoxysulfanylacetate |
|---|---|
| PubChem CID | 59547558 |
| Molecular Formula | C14H19F2O7S- |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | [3-hydroxy-5-(hydroxymethyl)-1-adamantyl]methyl 2,2-difluoro-2-oxidoperoxysulfanylacetate |
| SMILES | O=C(OCC12CC3CC(O)(CC(CO)(C3)C1)C2)C(F)(F)SOO[O-] |
| InChI | InChI=1S/C14H20F2O7S/c15-14(16,24-23-22-20)10(18)21-8-12-2-9-1-11(4-12,7-17)5-13(19,3-9)6-12/h9,17,19-20H,1-8H2/p-1 |
| InChIKey | REHVVOKHDKQIND-UHFFFAOYSA-M |
| XLogP | 0.69 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|