C15H22F2O7S — CID 87157316
1,1-difluoro-2-[[3-(hydroxymethyl)-5-methoxy-1-adamantyl]methoxy]-2-oxoethanesulfonic acid (PubChem CID 87157316) has the molecular formula C15H22F2O7S and a molecular weight of 384.40 g/mol. Its IUPAC name is 1,1-difluoro-2-[[3-(hydroxymethyl)-5-methoxy-1-adamantyl]methoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[3-(hydroxymethyl)-5-methoxy-1-adamantyl]methoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 87157316 |
| Molecular Formula | C15H22F2O7S |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 1,1-difluoro-2-[[3-(hydroxymethyl)-5-methoxy-1-adamantyl]methoxy]-2-oxoethanesulfonic acid |
| SMILES | COC12CC3CC(CO)(CC(COC(=O)C(F)(F)S(=O)(=O)O)(C3)C1)C2 |
| InChI | InChI=1S/C15H22F2O7S/c1-23-14-4-10-2-12(6-14,8-18)5-13(3-10,7-14)9-24-11(19)15(16,17)25(20,21)22/h10,18H,2-9H2,1H3,(H,20,21,22) |
| InChIKey | CHIQQCBITXPZLN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|