C13H18F2O6S — CID 146973029
1,1-difluoro-2-[(7-hydroxy-7-methyl-1-tricyclo[3.3.1.03,9]nonanyl)methoxy]-2-oxoethanesulfonic acid (PubChem CID 146973029) has the molecular formula C13H18F2O6S and a molecular weight of 340.34 g/mol. Its IUPAC name is 1,1-difluoro-2-[(7-hydroxy-7-methyl-1-tricyclo[3.3.1.03,9]nonanyl)methoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[(7-hydroxy-7-methyl-1-tricyclo[3.3.1.03,9]nonanyl)methoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 146973029 |
| Molecular Formula | C13H18F2O6S |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 1,1-difluoro-2-[(7-hydroxy-7-methyl-1-tricyclo[3.3.1.03,9]nonanyl)methoxy]-2-oxoethanesulfonic acid |
| SMILES | CC1(O)CC2CC3CC(COC(=O)C(F)(F)S(=O)(=O)O)(C1)C23 |
| InChI | InChI=1S/C13H18F2O6S/c1-11(17)3-7-2-8-4-12(5-11,9(7)8)6-21-10(16)13(14,15)22(18,19)20/h7-9,17H,2-6H2,1H3,(H,18,19,20) |
| InChIKey | AMUQCTQVZWEKGU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|