C18H20F2O5S — CID 163888019
1,1-difluoro-2-[[5-(4-methylphenyl)-3-tricyclo[3.2.1.03,6]octanyl]methoxy]-2-oxoethanesulfonic acid (PubChem CID 163888019) has the molecular formula C18H20F2O5S and a molecular weight of 386.42 g/mol. Its IUPAC name is 1,1-difluoro-2-[[5-(4-methylphenyl)-3-tricyclo[3.2.1.03,6]octanyl]methoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[5-(4-methylphenyl)-3-tricyclo[3.2.1.03,6]octanyl]methoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 163888019 |
| Molecular Formula | C18H20F2O5S |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 1,1-difluoro-2-[[5-(4-methylphenyl)-3-tricyclo[3.2.1.03,6]octanyl]methoxy]-2-oxoethanesulfonic acid |
| SMILES | Cc1ccc(C23CC4CC2C(COC(=O)C(F)(F)S(=O)(=O)O)(C4)C3)cc1 |
| InChI | InChI=1S/C18H20F2O5S/c1-11-2-4-13(5-3-11)17-8-12-6-14(17)16(7-12,9-17)10-25-15(21)18(19,20)26(22,23)24/h2-5,12,14H,6-10H2,1H3,(H,22,23,24) |
| InChIKey | PZCCJSHCAPZDFZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|