C20H24F2O6S — CID 88954565
1,1-difluoro-2-oxo-2-[2-[(3-phenyl-1-adamantyl)oxy]ethoxy]ethanesulfonic acid (PubChem CID 88954565) has the molecular formula C20H24F2O6S and a molecular weight of 430.47 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[2-[(3-phenyl-1-adamantyl)oxy]ethoxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[2-[(3-phenyl-1-adamantyl)oxy]ethoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 88954565 |
| Molecular Formula | C20H24F2O6S |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[2-[(3-phenyl-1-adamantyl)oxy]ethoxy]ethanesulfonic acid |
| SMILES | O=C(OCCOC12CC3CC(C1)CC(c1ccccc1)(C3)C2)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C20H24F2O6S/c21-20(22,29(24,25)26)17(23)27-6-7-28-19-11-14-8-15(12-19)10-18(9-14,13-19)16-4-2-1-3-5-16/h1-5,14-15H,6-13H2,(H,24,25,26) |
| InChIKey | AUPJLUHRQXISPF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|