C12H14F2O6S — CID 89185347
1,1-difluoro-2-oxo-2-[2-(2-phenylethoxy)ethoxy]ethanesulfonic acid (PubChem CID 89185347) has the molecular formula C12H14F2O6S and a molecular weight of 324.30 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[2-(2-phenylethoxy)ethoxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[2-(2-phenylethoxy)ethoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 89185347 |
| Molecular Formula | C12H14F2O6S |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[2-(2-phenylethoxy)ethoxy]ethanesulfonic acid |
| SMILES | O=C(OCCOCCc1ccccc1)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C12H14F2O6S/c13-12(14,21(16,17)18)11(15)20-9-8-19-7-6-10-4-2-1-3-5-10/h1-5H,6-9H2,(H,16,17,18) |
| InChIKey | PLRZXNXJRXBZBN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|