About 2-phenylethyl (2S)-2-(trifluoromethylsulfonyloxy)butanoate
2-phenylethyl (2S)-2-(trifluoromethylsulfonyloxy)butanoate (PubChem CID 140526627) has the molecular formula C13H15F3O5S
and a molecular weight of 340.32 g/mol. Its IUPAC name is 2-phenylethyl (2S)-2-(trifluoromethylsulfonyloxy)butanoate.
Molecular Properties
| Compound Name | 2-phenylethyl (2S)-2-(trifluoromethylsulfonyloxy)butanoate |
| PubChem CID | 140526627 |
| Molecular Formula | C13H15F3O5S |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 2-phenylethyl (2S)-2-(trifluoromethylsulfonyloxy)butanoate |
| SMILES | CC[C@H](OS(=O)(=O)C(F)(F)F)C(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C13H15F3O5S/c1-2-11(21-22(18,19)13(14,15)16)12(17)20-9-8-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3/t11-/m0/s1 |
| InChIKey | JJAOYJDJJMLEJN-NSHDSACASA-N |
| XLogP | 2.42 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethyl (2S)-2-(trifluoromethylsulfonyloxy)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl (2S)-2-(trifluoromethylsulfonyloxy)butanoate?
The IUPAC name of 2-phenylethyl (2S)-2-(trifluoromethylsulfonyloxy)butanoate (CID 140526627) is 2-phenylethyl (2S)-2-(trifluoromethylsulfonyloxy)butanoate.
What is the SMILES notation for 2-phenylethyl (2S)-2-(trifluoromethylsulfonyloxy)butanoate?
The canonical SMILES for 2-phenylethyl (2S)-2-(trifluoromethylsulfonyloxy)butanoate is CC[C@H](OS(=O)(=O)C(F)(F)F)C(=O)OCCc1ccccc1.
What is the InChIKey of 2-phenylethyl (2S)-2-(trifluoromethylsulfonyloxy)butanoate?
The InChIKey is JJAOYJDJJMLEJN-NSHDSACASA-N. The full InChI is InChI=1S/C13H15F3O5S/c1-2-11(21-22(18,19)13(14,15)16)12(17)20-9-8-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3/t11-/m0/s1.
What are the key properties of 2-phenylethyl (2S)-2-(trifluoromethylsulfonyloxy)butanoate?
2-phenylethyl (2S)-2-(trifluoromethylsulfonyloxy)butanoate has a molecular weight of 340.32 g/mol, XLogP of 2.42, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl (2S)-2-(trifluoromethylsulfonyloxy)butanoate is sourced from PubChem (CID 140526627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).