C10H8F3O5S- — CID 18926415
3-phenyl-2-(trifluoromethylsulfonyloxy)propanoate (PubChem CID 18926415) has the molecular formula C10H8F3O5S- and a molecular weight of 297.23 g/mol. Its IUPAC name is 3-phenyl-2-(trifluoromethylsulfonyloxy)propanoate.
| Compound Name | 3-phenyl-2-(trifluoromethylsulfonyloxy)propanoate |
|---|---|
| PubChem CID | 18926415 |
| Molecular Formula | C10H8F3O5S- |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 3-phenyl-2-(trifluoromethylsulfonyloxy)propanoate |
| SMILES | O=C([O-])C(Cc1ccccc1)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H9F3O5S/c11-10(12,13)19(16,17)18-8(9(14)15)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H,14,15)/p-1 |
| InChIKey | RAQSXWPGCMMJAW-UHFFFAOYSA-M |
| XLogP | 0.21 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|