C10H8F6O3S — CID 101332301
(1,1,1-trifluoro-3-phenylpropan-2-yl) trifluoromethanesulfonate (PubChem CID 101332301) has the molecular formula C10H8F6O3S and a molecular weight of 322.23 g/mol. Its IUPAC name is (1,1,1-trifluoro-3-phenylpropan-2-yl) trifluoromethanesulfonate.
| Compound Name | (1,1,1-trifluoro-3-phenylpropan-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101332301 |
| Molecular Formula | C10H8F6O3S |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | (1,1,1-trifluoro-3-phenylpropan-2-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC(Cc1ccccc1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H8F6O3S/c11-9(12,13)8(6-7-4-2-1-3-5-7)19-20(17,18)10(14,15)16/h1-5,8H,6H2 |
| InChIKey | IPBXKQCLHWMXIM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|