C12H16F2O6S — CID 146889970
1,1-difluoro-2-[(3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl)methoxy]-2-oxoethanesulfonic acid (PubChem CID 146889970) has the molecular formula C12H16F2O6S and a molecular weight of 326.32 g/mol. Its IUPAC name is 1,1-difluoro-2-[(3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl)methoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[(3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl)methoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 146889970 |
| Molecular Formula | C12H16F2O6S |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 1,1-difluoro-2-[(3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl)methoxy]-2-oxoethanesulfonic acid |
| SMILES | O=C(OCC12CC3CC(C1)C(O)(C3)C2)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C12H16F2O6S/c13-12(14,21(17,18)19)9(15)20-6-10-2-7-1-8(4-10)11(16,3-7)5-10/h7-8,16H,1-6H2,(H,17,18,19) |
| InChIKey | SYZYBMOMASRQSA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|