C24H29F2O9S- — CID 59171082
[3-[[2-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)acetyl]oxymethyl]-1-adamantyl]methyl 2,2-difluoro-2-oxidoperoxysulfanylacetate (PubChem CID 59171082) has the molecular formula C24H29F2O9S- and a molecular weight of 531.55 g/mol. Its IUPAC name is [3-[[2-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)acetyl]oxymethyl]-1-adamantyl]methyl 2,2-difluoro-2-oxidoperoxysulfanylacetate.
| Compound Name | [3-[[2-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)acetyl]oxymethyl]-1-adamantyl]methyl 2,2-difluoro-2-oxidoperoxysulfanylacetate |
|---|---|
| PubChem CID | 59171082 |
| Molecular Formula | C24H29F2O9S- |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | [3-[[2-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)acetyl]oxymethyl]-1-adamantyl]methyl 2,2-difluoro-2-oxidoperoxysulfanylacetate |
| SMILES | O=C(CC1C2CC3C(=O)OC1C3C2)OCC12CC3CC(C1)CC(COC(=O)C(F)(F)SOO[O-])(C3)C2 |
| InChI | InChI=1S/C24H30F2O9S/c25-24(26,36-35-34-30)21(29)32-11-23-7-12-1-13(8-23)6-22(5-12,9-23)10-31-18(27)4-15-14-2-16-17(3-14)20(28)33-19(15)16/h12-17,19,30H,1-11H2/p-1 |
| InChIKey | NOLDFYNGYCRWAO-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|