C15H16F2O10S — CID 59502962
(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)methyl 4-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxy-3-oxobutanoate (PubChem CID 59502962) has the molecular formula C15H16F2O10S and a molecular weight of 426.35 g/mol. Its IUPAC name is (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)methyl 4-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxy-3-oxobutanoate.
| Compound Name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)methyl 4-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxy-3-oxobutanoate |
|---|---|
| PubChem CID | 59502962 |
| Molecular Formula | C15H16F2O10S |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)methyl 4-[2,2-difluoro-2-(trioxidanylsulfanyl)acetyl]oxy-3-oxobutanoate |
| SMILES | O=C(COC(=O)C(F)(F)SOOO)CC(=O)OCC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C15H16F2O10S/c16-15(17,28-27-26-22)14(21)24-4-7(18)3-11(19)23-5-10-6-1-8-9(2-6)13(20)25-12(8)10/h6,8-10,12,22H,1-5H2 |
| InChIKey | GOFICTKLIDVZKS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|