C9H10F2O9S — CID 59440593
[2-oxo-2-(2-oxooxan-3-yl)oxyethyl] 2,2-difluoro-2-(trioxidanylsulfanyl)acetate (PubChem CID 59440593) has the molecular formula C9H10F2O9S and a molecular weight of 332.23 g/mol. Its IUPAC name is [2-oxo-2-(2-oxooxan-3-yl)oxyethyl] 2,2-difluoro-2-(trioxidanylsulfanyl)acetate.
| Compound Name | [2-oxo-2-(2-oxooxan-3-yl)oxyethyl] 2,2-difluoro-2-(trioxidanylsulfanyl)acetate |
|---|---|
| PubChem CID | 59440593 |
| Molecular Formula | C9H10F2O9S |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | [2-oxo-2-(2-oxooxan-3-yl)oxyethyl] 2,2-difluoro-2-(trioxidanylsulfanyl)acetate |
| SMILES | O=C(COC(=O)C(F)(F)SOOO)OC1CCCOC1=O |
| InChI | InChI=1S/C9H10F2O9S/c10-9(11,21-20-19-15)8(14)17-4-6(12)18-5-2-1-3-16-7(5)13/h5,15H,1-4H2 |
| InChIKey | GHPCONCOOAHZLX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|