C9H14F2O6S — CID 58937250
[1-(hydroxymethyl)cyclopentyl]methyl 2,2-difluoro-2-(trioxidanylsulfanyl)acetate (PubChem CID 58937250) has the molecular formula C9H14F2O6S and a molecular weight of 288.27 g/mol. Its IUPAC name is [1-(hydroxymethyl)cyclopentyl]methyl 2,2-difluoro-2-(trioxidanylsulfanyl)acetate.
| Compound Name | [1-(hydroxymethyl)cyclopentyl]methyl 2,2-difluoro-2-(trioxidanylsulfanyl)acetate |
|---|---|
| PubChem CID | 58937250 |
| Molecular Formula | C9H14F2O6S |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | [1-(hydroxymethyl)cyclopentyl]methyl 2,2-difluoro-2-(trioxidanylsulfanyl)acetate |
| SMILES | O=C(OCC1(CO)CCCC1)C(F)(F)SOOO |
| InChI | InChI=1S/C9H14F2O6S/c10-9(11,18-17-16-14)7(13)15-6-8(5-12)3-1-2-4-8/h12,14H,1-6H2 |
| InChIKey | XMJNFMRIZOPICP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|