About [1-(hydroxymethyl)cyclobutyl]methyl 2,2-difluoropropanoate
[1-(hydroxymethyl)cyclobutyl]methyl 2,2-difluoropropanoate (PubChem CID 59602505) has the molecular formula C9H14F2O3
and a molecular weight of 208.20 g/mol. Its IUPAC name is [1-(hydroxymethyl)cyclobutyl]methyl 2,2-difluoropropanoate.
Analyze [1-(hydroxymethyl)cyclobutyl]methyl 2,2-difluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(hydroxymethyl)cyclobutyl]methyl 2,2-difluoropropanoate?
The IUPAC name of [1-(hydroxymethyl)cyclobutyl]methyl 2,2-difluoropropanoate (CID 59602505) is [1-(hydroxymethyl)cyclobutyl]methyl 2,2-difluoropropanoate.
What is the SMILES notation for [1-(hydroxymethyl)cyclobutyl]methyl 2,2-difluoropropanoate?
The canonical SMILES for [1-(hydroxymethyl)cyclobutyl]methyl 2,2-difluoropropanoate is CC(F)(F)C(=O)OCC1(CO)CCC1.
What is the InChIKey of [1-(hydroxymethyl)cyclobutyl]methyl 2,2-difluoropropanoate?
The InChIKey is OFSYQCSNKORHOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2O3/c1-8(10,11)7(13)14-6-9(5-12)3-2-4-9/h12H,2-6H2,1H3.
What are the key properties of [1-(hydroxymethyl)cyclobutyl]methyl 2,2-difluoropropanoate?
[1-(hydroxymethyl)cyclobutyl]methyl 2,2-difluoropropanoate has a molecular weight of 208.20 g/mol, XLogP of 1.35, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(hydroxymethyl)cyclobutyl]methyl 2,2-difluoropropanoate is sourced from PubChem (CID 59602505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).