C17H18F10O5S — CID 140513493
1-adamantylmethyl 2,3,3,4,4,5,5,6,6,6-decafluoro-2-(trioxidanylsulfanyl)hexanoate (PubChem CID 140513493) has the molecular formula C17H18F10O5S and a molecular weight of 524.37 g/mol. Its IUPAC name is 1-adamantylmethyl 2,3,3,4,4,5,5,6,6,6-decafluoro-2-(trioxidanylsulfanyl)hexanoate.
| Compound Name | 1-adamantylmethyl 2,3,3,4,4,5,5,6,6,6-decafluoro-2-(trioxidanylsulfanyl)hexanoate |
|---|---|
| PubChem CID | 140513493 |
| Molecular Formula | C17H18F10O5S |
| Molecular Weight | 524.37 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | 1-adamantylmethyl 2,3,3,4,4,5,5,6,6,6-decafluoro-2-(trioxidanylsulfanyl)hexanoate |
| SMILES | O=C(OCC12CC3CC(CC(C3)C1)C2)C(F)(SOOO)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H18F10O5S/c18-13(33-32-31-29,14(19,20)15(21,22)16(23,24)17(25,26)27)11(28)30-7-12-4-8-1-9(5-12)3-10(2-8)6-12/h8-10,29H,1-7H2 |
| InChIKey | BXNZZBBSBRXDND-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.37 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|