C17H17F11O3 — CID 59641386
1-adamantylmethyl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate (PubChem CID 59641386) has the molecular formula C17H17F11O3 and a molecular weight of 478.30 g/mol. Its IUPAC name is 1-adamantylmethyl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate.
| Compound Name | 1-adamantylmethyl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
|---|---|
| PubChem CID | 59641386 |
| Molecular Formula | C17H17F11O3 |
| Molecular Weight | 478.30 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 1-adamantylmethyl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
| SMILES | O=C(OCC12CC3CC(CC(C3)C1)C2)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H17F11O3/c18-13(15(21,22)23,31-17(27,28)14(19,20)16(24,25)26)11(29)30-7-12-4-8-1-9(5-12)3-10(2-8)6-12/h8-10H,1-7H2 |
| InChIKey | ATYBJTJAXUUKJZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.30 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|