C16H20F4O7S — CID 87141637
3-[2-(1-adamantylmethoxy)-2-oxoethoxy]-1,1,1,2-tetrafluoro-3-oxopropane-2-sulfonic acid (PubChem CID 87141637) has the molecular formula C16H20F4O7S and a molecular weight of 432.39 g/mol. Its IUPAC name is 3-[2-(1-adamantylmethoxy)-2-oxoethoxy]-1,1,1,2-tetrafluoro-3-oxopropane-2-sulfonic acid.
| Compound Name | 3-[2-(1-adamantylmethoxy)-2-oxoethoxy]-1,1,1,2-tetrafluoro-3-oxopropane-2-sulfonic acid |
|---|---|
| PubChem CID | 87141637 |
| Molecular Formula | C16H20F4O7S |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 3-[2-(1-adamantylmethoxy)-2-oxoethoxy]-1,1,1,2-tetrafluoro-3-oxopropane-2-sulfonic acid |
| SMILES | O=C(COC(=O)C(F)(C(F)(F)F)S(=O)(=O)O)OCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H20F4O7S/c17-15(16(18,19)20,28(23,24)25)13(22)26-7-12(21)27-8-14-4-9-1-10(5-14)3-11(2-9)6-14/h9-11H,1-8H2,(H,23,24,25) |
| InChIKey | JZIFACFKISPLES-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|