C13H16F4O5S — CID 89040622
3-(1-adamantyloxy)-1,1,1,2-tetrafluoro-3-oxopropane-2-sulfonic acid (PubChem CID 89040622) has the molecular formula C13H16F4O5S and a molecular weight of 360.33 g/mol. Its IUPAC name is 3-(1-adamantyloxy)-1,1,1,2-tetrafluoro-3-oxopropane-2-sulfonic acid.
| Compound Name | 3-(1-adamantyloxy)-1,1,1,2-tetrafluoro-3-oxopropane-2-sulfonic acid |
|---|---|
| PubChem CID | 89040622 |
| Molecular Formula | C13H16F4O5S |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 3-(1-adamantyloxy)-1,1,1,2-tetrafluoro-3-oxopropane-2-sulfonic acid |
| SMILES | O=C(OC12CC3CC(CC(C3)C1)C2)C(F)(C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C13H16F4O5S/c14-12(13(15,16)17,23(19,20)21)10(18)22-11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H,19,20,21) |
| InChIKey | IMZRTZHPHLVBSA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|