C15H16F8O6S — CID 87412498
1,1,1,3,3,4,4,4-octafluoro-2-[(4-hydroxy-1-adamantyl)oxycarbonyl]butane-2-sulfonic acid (PubChem CID 87412498) has the molecular formula C15H16F8O6S and a molecular weight of 476.34 g/mol. Its IUPAC name is 1,1,1,3,3,4,4,4-octafluoro-2-[(4-hydroxy-1-adamantyl)oxycarbonyl]butane-2-sulfonic acid.
| Compound Name | 1,1,1,3,3,4,4,4-octafluoro-2-[(4-hydroxy-1-adamantyl)oxycarbonyl]butane-2-sulfonic acid |
|---|---|
| PubChem CID | 87412498 |
| Molecular Formula | C15H16F8O6S |
| Molecular Weight | 476.34 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | 1,1,1,3,3,4,4,4-octafluoro-2-[(4-hydroxy-1-adamantyl)oxycarbonyl]butane-2-sulfonic acid |
| SMILES | O=C(OC12CC3CC(C1)C(O)C(C3)C2)C(C(F)(F)F)(C(F)(F)C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C15H16F8O6S/c16-13(17,15(21,22)23)12(14(18,19)20,30(26,27)28)10(25)29-11-3-6-1-7(4-11)9(24)8(2-6)5-11/h6-9,24H,1-5H2,(H,26,27,28) |
| InChIKey | PMQJEUAYTYJXAM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|