About (4-hydroxy-1-adamantyl) 2-fluoro-2-(trioxidanylsulfanyl)octanoate
(4-hydroxy-1-adamantyl) 2-fluoro-2-(trioxidanylsulfanyl)octanoate (PubChem CID 59228942) has the molecular formula C18H29FO6S
and a molecular weight of 392.49 g/mol. Its IUPAC name is (4-hydroxy-1-adamantyl) 2-fluoro-2-(trioxidanylsulfanyl)octanoate.
Molecular Properties
| Compound Name | (4-hydroxy-1-adamantyl) 2-fluoro-2-(trioxidanylsulfanyl)octanoate |
| PubChem CID | 59228942 |
| Molecular Formula | C18H29FO6S |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (4-hydroxy-1-adamantyl) 2-fluoro-2-(trioxidanylsulfanyl)octanoate |
| SMILES | CCCCCCC(F)(SOOO)C(=O)OC12CC3CC(C1)C(O)C(C3)C2 |
| InChI | InChI=1S/C18H29FO6S/c1-2-3-4-5-6-18(19,26-25-24-22)16(21)23-17-9-12-7-13(10-17)15(20)14(8-12)11-17/h12-15,20,22H,2-11H2,1H3 |
| InChIKey | RPVRNQYFRMCASL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxy-1-adamantyl) 2-fluoro-2-(trioxidanylsulfanyl)octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-1-adamantyl) 2-fluoro-2-(trioxidanylsulfanyl)octanoate?
The IUPAC name of (4-hydroxy-1-adamantyl) 2-fluoro-2-(trioxidanylsulfanyl)octanoate (CID 59228942) is (4-hydroxy-1-adamantyl) 2-fluoro-2-(trioxidanylsulfanyl)octanoate.
What is the SMILES notation for (4-hydroxy-1-adamantyl) 2-fluoro-2-(trioxidanylsulfanyl)octanoate?
The canonical SMILES for (4-hydroxy-1-adamantyl) 2-fluoro-2-(trioxidanylsulfanyl)octanoate is CCCCCCC(F)(SOOO)C(=O)OC12CC3CC(C1)C(O)C(C3)C2.
What is the InChIKey of (4-hydroxy-1-adamantyl) 2-fluoro-2-(trioxidanylsulfanyl)octanoate?
The InChIKey is RPVRNQYFRMCASL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29FO6S/c1-2-3-4-5-6-18(19,26-25-24-22)16(21)23-17-9-12-7-13(10-17)15(20)14(8-12)11-17/h12-15,20,22H,2-11H2,1H3.
What are the key properties of (4-hydroxy-1-adamantyl) 2-fluoro-2-(trioxidanylsulfanyl)octanoate?
(4-hydroxy-1-adamantyl) 2-fluoro-2-(trioxidanylsulfanyl)octanoate has a molecular weight of 392.49 g/mol, XLogP of 4.17, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-1-adamantyl) 2-fluoro-2-(trioxidanylsulfanyl)octanoate is sourced from PubChem (CID 59228942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).