C26H46O4 — CID 158928757
1-adamantyl 2,2-dimethylbutanoate;butyl 2,2-dimethylbutanoate (PubChem CID 158928757) has the molecular formula C26H46O4 and a molecular weight of 422.65 g/mol. Its IUPAC name is 1-adamantyl 2,2-dimethylbutanoate;butyl 2,2-dimethylbutanoate.
| Compound Name | 1-adamantyl 2,2-dimethylbutanoate;butyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 158928757 |
| Molecular Formula | C26H46O4 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.34 |
| IUPAC Name | 1-adamantyl 2,2-dimethylbutanoate;butyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC12CC3CC(CC(C3)C1)C2.CCCCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C16H26O2.C10H20O2/c1-4-15(2,3)14(17)18-16-8-11-5-12(9-16)7-13(6-11)10-16;1-5-7-8-12-9(11)10(3,4)6-2/h11-13H,4-10H2,1-3H3;5-8H2,1-4H3 |
| InChIKey | JITVJDZYEYSXAC-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|