C21H34O4 — CID 59326379
[4-[(5-methyl-2-adamantyl)oxy]-4-oxobutyl] 2,2-dimethylbutanoate (PubChem CID 59326379) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is [4-[(5-methyl-2-adamantyl)oxy]-4-oxobutyl] 2,2-dimethylbutanoate.
| Compound Name | [4-[(5-methyl-2-adamantyl)oxy]-4-oxobutyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59326379 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | [4-[(5-methyl-2-adamantyl)oxy]-4-oxobutyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCCC(=O)OC1C2CC3CC1CC(C)(C3)C2 |
| InChI | InChI=1S/C21H34O4/c1-5-20(2,3)19(23)24-8-6-7-17(22)25-18-15-9-14-10-16(18)13-21(4,11-14)12-15/h14-16,18H,5-13H2,1-4H3 |
| InChIKey | ZBKGOBQQUXVRMU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|