C16H26O4 — CID 18336296
(3,5-dihydroxy-1-adamantyl) 2,2-dimethylbutanoate (PubChem CID 18336296) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (3,5-dihydroxy-1-adamantyl) 2,2-dimethylbutanoate.
| Compound Name | (3,5-dihydroxy-1-adamantyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 18336296 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (3,5-dihydroxy-1-adamantyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC12CC3CC(O)(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C16H26O4/c1-4-13(2,3)12(17)20-16-7-11-5-14(18,9-16)8-15(19,6-11)10-16/h11,18-19H,4-10H2,1-3H3 |
| InChIKey | AGHKORFOMFRIHF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |