C20H34O4 — CID 123790866
(3,5-dihydroxy-1-adamantyl) 2-tert-butyl-2-methylpentanoate (PubChem CID 123790866) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is (3,5-dihydroxy-1-adamantyl) 2-tert-butyl-2-methylpentanoate.
| Compound Name | (3,5-dihydroxy-1-adamantyl) 2-tert-butyl-2-methylpentanoate |
|---|---|
| PubChem CID | 123790866 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | (3,5-dihydroxy-1-adamantyl) 2-tert-butyl-2-methylpentanoate |
| SMILES | CCCC(C)(C(=O)OC12CC3CC(O)(CC(O)(C3)C1)C2)C(C)(C)C |
| InChI | InChI=1S/C20H34O4/c1-6-7-17(5,16(2,3)4)15(21)24-20-10-14-8-18(22,12-20)11-19(23,9-14)13-20/h14,22-23H,6-13H2,1-5H3 |
| InChIKey | CQTOLJFFVJMCOI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |