C17H22F3NO3 — CID 21063648
(3-cyano-5-hydroxy-1-adamantyl) 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 21063648) has the molecular formula C17H22F3NO3 and a molecular weight of 345.36 g/mol. Its IUPAC name is (3-cyano-5-hydroxy-1-adamantyl) 2-methyl-2-(trifluoromethyl)butanoate.
| Compound Name | (3-cyano-5-hydroxy-1-adamantyl) 2-methyl-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 21063648 |
| Molecular Formula | C17H22F3NO3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (3-cyano-5-hydroxy-1-adamantyl) 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC(C)(C(=O)OC12CC3CC(O)(CC(C#N)(C3)C1)C2)C(F)(F)F |
| InChI | InChI=1S/C17H22F3NO3/c1-3-13(2,17(18,19)20)12(22)24-16-6-11-4-14(8-16,10-21)7-15(23,5-11)9-16/h11,23H,3-9H2,1-2H3 |
| InChIKey | RIEOXWPDSLLHLM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |