C22H38O3 — CID 58961909
(3-hydroxy-1-adamantyl) 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 58961909) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl) 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | (3-hydroxy-1-adamantyl) 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 58961909 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | (3-hydroxy-1-adamantyl) 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC(C)(C)CC(C)(C(=O)OC12CC3CC(CC(O)(C3)C1)C2)C(C)(C)C |
| InChI | InChI=1S/C22H38O3/c1-18(2,3)13-20(7,19(4,5)6)17(23)25-22-11-15-8-16(12-22)10-21(24,9-15)14-22/h15-16,24H,8-14H2,1-7H3 |
| InChIKey | GXKUICNCSFGGPO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |