C21H35ClO2 — CID 139519763
1-adamantyl 2-tert-butyl-2-chloro-4,4-dimethylpentanoate (PubChem CID 139519763) has the molecular formula C21H35ClO2 and a molecular weight of 354.96 g/mol. Its IUPAC name is 1-adamantyl 2-tert-butyl-2-chloro-4,4-dimethylpentanoate.
| Compound Name | 1-adamantyl 2-tert-butyl-2-chloro-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 139519763 |
| Molecular Formula | C21H35ClO2 |
| Molecular Weight | 354.96 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 1-adamantyl 2-tert-butyl-2-chloro-4,4-dimethylpentanoate |
| SMILES | CC(C)(C)CC(Cl)(C(=O)OC12CC3CC(CC(C3)C1)C2)C(C)(C)C |
| InChI | InChI=1S/C21H35ClO2/c1-18(2,3)13-21(22,19(4,5)6)17(23)24-20-10-14-7-15(11-20)9-16(8-14)12-20/h14-16H,7-13H2,1-6H3 |
| InChIKey | LBYFKKHGJQBYRQ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.96 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|