About 8-(1-adamantyloxy)-7,7-dimethyl-6,8-dioxooctane-1-sulfonate
8-(1-adamantyloxy)-7,7-dimethyl-6,8-dioxooctane-1-sulfonate (PubChem CID 155764704) has the molecular formula C20H31O6S-
and a molecular weight of 399.53 g/mol. Its IUPAC name is 8-(1-adamantyloxy)-7,7-dimethyl-6,8-dioxooctane-1-sulfonate.
Molecular Properties
| Compound Name | 8-(1-adamantyloxy)-7,7-dimethyl-6,8-dioxooctane-1-sulfonate |
| PubChem CID | 155764704 |
| Molecular Formula | C20H31O6S- |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 8-(1-adamantyloxy)-7,7-dimethyl-6,8-dioxooctane-1-sulfonate |
| SMILES | CC(C)(C(=O)CCCCCS(=O)(=O)[O-])C(=O)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H32O6S/c1-19(2,17(21)6-4-3-5-7-27(23,24)25)18(22)26-20-11-14-8-15(12-20)10-16(9-14)13-20/h14-16H,3-13H2,1-2H3,(H,23,24,25)/p-1 |
| InChIKey | MERAZOMXXSTKEX-UHFFFAOYSA-M |
| XLogP | 3.20 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 8-(1-adamantyloxy)-7,7-dimethyl-6,8-dioxooctane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1-adamantyloxy)-7,7-dimethyl-6,8-dioxooctane-1-sulfonate?
The IUPAC name of 8-(1-adamantyloxy)-7,7-dimethyl-6,8-dioxooctane-1-sulfonate (CID 155764704) is 8-(1-adamantyloxy)-7,7-dimethyl-6,8-dioxooctane-1-sulfonate.
What is the SMILES notation for 8-(1-adamantyloxy)-7,7-dimethyl-6,8-dioxooctane-1-sulfonate?
The canonical SMILES for 8-(1-adamantyloxy)-7,7-dimethyl-6,8-dioxooctane-1-sulfonate is CC(C)(C(=O)CCCCCS(=O)(=O)[O-])C(=O)OC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 8-(1-adamantyloxy)-7,7-dimethyl-6,8-dioxooctane-1-sulfonate?
The InChIKey is MERAZOMXXSTKEX-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H32O6S/c1-19(2,17(21)6-4-3-5-7-27(23,24)25)18(22)26-20-11-14-8-15(12-20)10-16(9-14)13-20/h14-16H,3-13H2,1-2H3,(H,23,24,25)/p-1.
What are the key properties of 8-(1-adamantyloxy)-7,7-dimethyl-6,8-dioxooctane-1-sulfonate?
8-(1-adamantyloxy)-7,7-dimethyl-6,8-dioxooctane-1-sulfonate has a molecular weight of 399.53 g/mol, XLogP of 3.20, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1-adamantyloxy)-7,7-dimethyl-6,8-dioxooctane-1-sulfonate is sourced from PubChem (CID 155764704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).