C15H21F2O5S- — CID 155764690
1-(1-adamantyloxy)-2,2-difluoro-1-oxopentane-3-sulfonate (PubChem CID 155764690) has the molecular formula C15H21F2O5S- and a molecular weight of 351.39 g/mol. Its IUPAC name is 1-(1-adamantyloxy)-2,2-difluoro-1-oxopentane-3-sulfonate.
| Compound Name | 1-(1-adamantyloxy)-2,2-difluoro-1-oxopentane-3-sulfonate |
|---|---|
| PubChem CID | 155764690 |
| Molecular Formula | C15H21F2O5S- |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 1-(1-adamantyloxy)-2,2-difluoro-1-oxopentane-3-sulfonate |
| SMILES | CCC(C(F)(F)C(=O)OC12CC3CC(CC(C3)C1)C2)S(=O)(=O)[O-] |
| InChI | InChI=1S/C15H22F2O5S/c1-2-12(23(19,20)21)15(16,17)13(18)22-14-6-9-3-10(7-14)5-11(4-9)8-14/h9-12H,2-8H2,1H3,(H,19,20,21)/p-1 |
| InChIKey | XDGBSMGTLTZYNH-UHFFFAOYSA-M |
| XLogP | 2.46 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|