C22H28F6O6 — CID 118909140
1-O-(1-adamantyl) 5-O-[2-(2-methylbutanoyloxy)ethyl] 2,2,3,3,4,4-hexafluoropentanedioate (PubChem CID 118909140) has the molecular formula C22H28F6O6 and a molecular weight of 502.45 g/mol. Its IUPAC name is 1-O-(1-adamantyl) 5-O-[2-(2-methylbutanoyloxy)ethyl] 2,2,3,3,4,4-hexafluoropentanedioate.
| Compound Name | 1-O-(1-adamantyl) 5-O-[2-(2-methylbutanoyloxy)ethyl] 2,2,3,3,4,4-hexafluoropentanedioate |
|---|---|
| PubChem CID | 118909140 |
| Molecular Formula | C22H28F6O6 |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 1-O-(1-adamantyl) 5-O-[2-(2-methylbutanoyloxy)ethyl] 2,2,3,3,4,4-hexafluoropentanedioate |
| SMILES | CCC(C)C(=O)OCCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H28F6O6/c1-3-12(2)16(29)32-4-5-33-17(30)20(23,24)22(27,28)21(25,26)18(31)34-19-9-13-6-14(10-19)8-15(7-13)11-19/h12-15H,3-11H2,1-2H3 |
| InChIKey | FNPAPTOHDSCSOG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|