C20H28F2O6 — CID 58108127
spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 5-(2,2-difluoropropanoyloxy)pentanoate (PubChem CID 58108127) has the molecular formula C20H28F2O6 and a molecular weight of 402.43 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 5-(2,2-difluoropropanoyloxy)pentanoate.
| Compound Name | spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 5-(2,2-difluoropropanoyloxy)pentanoate |
|---|---|
| PubChem CID | 58108127 |
| Molecular Formula | C20H28F2O6 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | spiro[1,3-dioxolane-2,4'-adamantane]-1'-yl 5-(2,2-difluoropropanoyloxy)pentanoate |
| SMILES | CC(F)(F)C(=O)OCCCCC(=O)OC12CC3CC(C1)C1(OCCO1)C(C3)C2 |
| InChI | InChI=1S/C20H28F2O6/c1-18(21,22)17(24)25-5-3-2-4-16(23)28-19-10-13-8-14(11-19)20(15(9-13)12-19)26-6-7-27-20/h13-15H,2-12H2,1H3 |
| InChIKey | JWFOOEIOVSXSDL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|