C18H23F5O4 — CID 89280319
[3-(2,2,3,3,3-pentafluoropropanoyloxy)-1-adamantyl] 2-methylbutanoate (PubChem CID 89280319) has the molecular formula C18H23F5O4 and a molecular weight of 398.37 g/mol. Its IUPAC name is [3-(2,2,3,3,3-pentafluoropropanoyloxy)-1-adamantyl] 2-methylbutanoate.
| Compound Name | [3-(2,2,3,3,3-pentafluoropropanoyloxy)-1-adamantyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 89280319 |
| Molecular Formula | C18H23F5O4 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | [3-(2,2,3,3,3-pentafluoropropanoyloxy)-1-adamantyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC12CC3CC(C1)CC(OC(=O)C(F)(F)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C18H23F5O4/c1-3-10(2)13(24)26-15-5-11-4-12(6-15)8-16(7-11,9-15)27-14(25)17(19,20)18(21,22)23/h10-12H,3-9H2,1-2H3 |
| InChIKey | KQAMCRCLCPGFEV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|