C17H23F3O4 — CID 121355082
3-[2-methyl-2-(trifluoromethyl)butanoyl]oxyadamantane-1-carboxylic acid (PubChem CID 121355082) has the molecular formula C17H23F3O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is 3-[2-methyl-2-(trifluoromethyl)butanoyl]oxyadamantane-1-carboxylic acid.
| Compound Name | 3-[2-methyl-2-(trifluoromethyl)butanoyl]oxyadamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 121355082 |
| Molecular Formula | C17H23F3O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 3-[2-methyl-2-(trifluoromethyl)butanoyl]oxyadamantane-1-carboxylic acid |
| SMILES | CCC(C)(C(=O)OC12CC3CC(C1)CC(C(=O)O)(C3)C2)C(F)(F)F |
| InChI | InChI=1S/C17H23F3O4/c1-3-14(2,17(18,19)20)13(23)24-16-7-10-4-11(8-16)6-15(5-10,9-16)12(21)22/h10-11H,3-9H2,1-2H3,(H,21,22) |
| InChIKey | WEODDFSYICEVPV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |