C22H23F15O3 — CID 21020813
[1,1,1,3,3,3-hexafluoro-2-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-adamantyl]propan-2-yl] 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 21020813) has the molecular formula C22H23F15O3 and a molecular weight of 620.39 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-adamantyl]propan-2-yl] 2-methyl-2-(trifluoromethyl)butanoate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-adamantyl]propan-2-yl] 2-methyl-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 21020813 |
| Molecular Formula | C22H23F15O3 |
| Molecular Weight | 620.39 g/mol |
| Exact Mass | 620.14 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1-adamantyl]propan-2-yl] 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC(C)(C(=O)OC(C(F)(F)F)(C(F)(F)F)C12CC3CC(CC(C(O)(C(F)(F)F)C(F)(F)F)(C3)C1)C2)C(F)(F)F |
| InChI | InChI=1S/C22H23F15O3/c1-3-13(2,18(23,24)25)12(38)40-17(21(32,33)34,22(35,36)37)15-7-10-4-11(8-15)6-14(5-10,9-15)16(39,19(26,27)28)20(29,30)31/h10-11,39H,3-9H2,1-2H3 |
| InChIKey | JVABTGXMSWAEOV-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.39 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |