C17H24F6O2 — CID 58820897
2-(3-butan-2-yloxy-1-adamantyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 58820897) has the molecular formula C17H24F6O2 and a molecular weight of 374.37 g/mol. Its IUPAC name is 2-(3-butan-2-yloxy-1-adamantyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(3-butan-2-yloxy-1-adamantyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 58820897 |
| Molecular Formula | C17H24F6O2 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-(3-butan-2-yloxy-1-adamantyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCC(C)OC12CC3CC(C1)CC(C(O)(C(F)(F)F)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C17H24F6O2/c1-3-10(2)25-14-7-11-4-12(8-14)6-13(5-11,9-14)15(24,16(18,19)20)17(21,22)23/h10-12,24H,3-9H2,1-2H3 |
| InChIKey | PKUDFPDDCHHADT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |