C17H23F3O3 — CID 59616251
[3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-1-adamantyl] 2-methylprop-2-enoate (PubChem CID 59616251) has the molecular formula C17H23F3O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is [3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-1-adamantyl] 2-methylprop-2-enoate.
| Compound Name | [3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-1-adamantyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59616251 |
| Molecular Formula | C17H23F3O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | [3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-1-adamantyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C1)CC(C(C)(O)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C17H23F3O3/c1-10(2)13(21)23-16-7-11-4-12(8-16)6-15(5-11,9-16)14(3,22)17(18,19)20/h11-12,22H,1,4-9H2,2-3H3 |
| InChIKey | SNUOTLFOJQFDPY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|