C26H40O6 — CID 131721837
1-adamantyl 2-methylprop-2-enoate;tert-butyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 131721837) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is 1-adamantyl 2-methylprop-2-enoate;tert-butyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid.
| Compound Name | 1-adamantyl 2-methylprop-2-enoate;tert-butyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 131721837 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 1-adamantyl 2-methylprop-2-enoate;tert-butyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OC(C)(C)C.C=C(C)C(=O)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H20O2.C8H14O2.C4H6O2/c1-9(2)13(15)16-14-6-10-3-11(7-14)5-12(4-10)8-14;1-6(2)7(9)10-8(3,4)5;1-3(2)4(5)6/h10-12H,1,3-8H2,2H3;1H2,2-5H3;1H2,2H3,(H,5,6) |
| InChIKey | UMXRAIIVEWGINB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|