About 1-adamantyl 2-methylprop-2-enoate;oxan-2-yl 2-hydroxyprop-2-enoate
1-adamantyl 2-methylprop-2-enoate;oxan-2-yl 2-hydroxyprop-2-enoate (PubChem CID 67611602) has the molecular formula C22H32O6
and a molecular weight of 392.49 g/mol. Its IUPAC name is 1-adamantyl 2-methylprop-2-enoate;oxan-2-yl 2-hydroxyprop-2-enoate.
Molecular Properties
| Compound Name | 1-adamantyl 2-methylprop-2-enoate;oxan-2-yl 2-hydroxyprop-2-enoate |
| PubChem CID | 67611602 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 1-adamantyl 2-methylprop-2-enoate;oxan-2-yl 2-hydroxyprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(CC(C3)C1)C2.C=C(O)C(=O)OC1CCCCO1 |
| InChI | InChI=1S/C14H20O2.C8H12O4/c1-9(2)13(15)16-14-6-10-3-11(7-14)5-12(4-10)8-14;1-6(9)8(10)12-7-4-2-3-5-11-7/h10-12H,1,3-8H2,2H3;7,9H,1-5H2 |
| InChIKey | YDHWVFOHVLQPDQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantyl 2-methylprop-2-enoate;oxan-2-yl 2-hydroxyprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl 2-methylprop-2-enoate;oxan-2-yl 2-hydroxyprop-2-enoate?
The IUPAC name of 1-adamantyl 2-methylprop-2-enoate;oxan-2-yl 2-hydroxyprop-2-enoate (CID 67611602) is 1-adamantyl 2-methylprop-2-enoate;oxan-2-yl 2-hydroxyprop-2-enoate.
What is the SMILES notation for 1-adamantyl 2-methylprop-2-enoate;oxan-2-yl 2-hydroxyprop-2-enoate?
The canonical SMILES for 1-adamantyl 2-methylprop-2-enoate;oxan-2-yl 2-hydroxyprop-2-enoate is C=C(C)C(=O)OC12CC3CC(CC(C3)C1)C2.C=C(O)C(=O)OC1CCCCO1.
What is the InChIKey of 1-adamantyl 2-methylprop-2-enoate;oxan-2-yl 2-hydroxyprop-2-enoate?
The InChIKey is YDHWVFOHVLQPDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2.C8H12O4/c1-9(2)13(15)16-14-6-10-3-11(7-14)5-12(4-10)8-14;1-6(9)8(10)12-7-4-2-3-5-11-7/h10-12H,1,3-8H2,2H3;7,9H,1-5H2.
What are the key properties of 1-adamantyl 2-methylprop-2-enoate;oxan-2-yl 2-hydroxyprop-2-enoate?
1-adamantyl 2-methylprop-2-enoate;oxan-2-yl 2-hydroxyprop-2-enoate has a molecular weight of 392.49 g/mol, XLogP of 4.20, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl 2-methylprop-2-enoate;oxan-2-yl 2-hydroxyprop-2-enoate is sourced from PubChem (CID 67611602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).