C19H26O5 — CID 139888995
oxolan-2-yl 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate (PubChem CID 139888995) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is oxolan-2-yl 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate.
| Compound Name | oxolan-2-yl 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 139888995 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | oxolan-2-yl 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C1)CC(C(=O)OC1CCCO1)(C3)C2 |
| InChI | InChI=1S/C19H26O5/c1-12(2)16(20)24-19-9-13-6-14(10-19)8-18(7-13,11-19)17(21)23-15-4-3-5-22-15/h13-15H,1,3-11H2,2H3 |
| InChIKey | YQOWEIFVFLJGST-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|