C27H40O8 — CID 89381941
[3-(2,2-dimethylpropoxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate (PubChem CID 89381941) has the molecular formula C27H40O8 and a molecular weight of 492.61 g/mol. Its IUPAC name is [3-(2,2-dimethylpropoxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate.
| Compound Name | [3-(2,2-dimethylpropoxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 89381941 |
| Molecular Formula | C27H40O8 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | [3-(2,2-dimethylpropoxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C1)CC(C(=O)OC1COC4C(OCOCC(C)(C)C)COC14)(C3)C2 |
| InChI | InChI=1S/C27H40O8/c1-16(2)23(28)35-27-9-17-6-18(10-27)8-26(7-17,13-27)24(29)34-20-12-32-21-19(11-31-22(20)21)33-15-30-14-25(3,4)5/h17-22H,1,6-15H2,2-5H3 |
| InChIKey | IKVXQDSGZRTYQI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|