C18H32O6 — CID 89182145
[3-(2,2-dimethylpropoxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2,2-dimethylbutanoate (PubChem CID 89182145) has the molecular formula C18H32O6 and a molecular weight of 344.45 g/mol. Its IUPAC name is [3-(2,2-dimethylpropoxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2,2-dimethylbutanoate.
| Compound Name | [3-(2,2-dimethylpropoxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 89182145 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | [3-(2,2-dimethylpropoxymethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1COC2C(OCOCC(C)(C)C)COC12 |
| InChI | InChI=1S/C18H32O6/c1-7-18(5,6)16(19)24-13-9-22-14-12(8-21-15(13)14)23-11-20-10-17(2,3)4/h12-15H,7-11H2,1-6H3 |
| InChIKey | JFAOKTTXEKFTHG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|