C24H38O7 — CID 58445587
[5-(1,4-dioxaspiro[4.5]decan-3-yl)spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-6-yl] 2,2-dimethylbutanoate (PubChem CID 58445587) has the molecular formula C24H38O7 and a molecular weight of 438.56 g/mol. Its IUPAC name is [5-(1,4-dioxaspiro[4.5]decan-3-yl)spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-6-yl] 2,2-dimethylbutanoate.
| Compound Name | [5-(1,4-dioxaspiro[4.5]decan-3-yl)spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-6-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58445587 |
| Molecular Formula | C24H38O7 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | [5-(1,4-dioxaspiro[4.5]decan-3-yl)spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-6-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1C(C2COC3(CCCCC3)O2)OC2OC3(CCCCC3)OC21 |
| InChI | InChI=1S/C24H38O7/c1-4-22(2,3)21(25)28-18-17(16-15-26-23(29-16)11-7-5-8-12-23)27-20-19(18)30-24(31-20)13-9-6-10-14-24/h16-20H,4-15H2,1-3H3 |
| InChIKey | VBAKVANCEBFDGX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |