C27H38O7 — CID 92509162
(3aR,5S,6R,6aR)-5-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-6-[(4-ethoxyphenyl)methoxy]spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane] (PubChem CID 92509162) has the molecular formula C27H38O7 and a molecular weight of 474.59 g/mol. Its IUPAC name is (3aR,5S,6R,6aR)-5-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-6-[(4-ethoxyphenyl)methoxy]spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane].
| Compound Name | (3aR,5S,6R,6aR)-5-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-6-[(4-ethoxyphenyl)methoxy]spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 92509162 |
| Molecular Formula | C27H38O7 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | (3aR,5S,6R,6aR)-5-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-6-[(4-ethoxyphenyl)methoxy]spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane] |
| SMILES | CCOc1ccc(CO[C@@H]2[C@H]([C@@H]3COC4(CCCCC4)O3)O[C@@H]3OC4(CCCCC4)O[C@@H]32)cc1 |
| InChI | InChI=1S/C27H38O7/c1-2-28-20-11-9-19(10-12-20)17-29-23-22(21-18-30-26(32-21)13-5-3-6-14-26)31-25-24(23)33-27(34-25)15-7-4-8-16-27/h9-12,21-25H,2-8,13-18H2,1H3/t21-,22-,23+,24+,25+/m0/s1 |
| InChIKey | XUIUVPHHFKBKNF-UBCNIHEASA-N |
| XLogP | 4.85 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |